84255-09-4 Usage
Chemical structure
A complex organic compound with a quinolinium cation and an iodide anion.
Composition
Contains a benzene ring with a selenazol-2-ylidene group attached to the quinolinium structure.
Potential applications
Organic synthesis, medicinal chemistry, and materials science due to its unique structure and properties.
Research status
Further research and testing are required to fully understand its potential uses and effects.
Please note that the specific content provided is limited, and a more detailed analysis of the compound's properties, such as its chemical reactivity, stability, and solubility, would require additional information.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-09-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84255-09:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*0)+(1*9)=134
134 % 10 = 4
So 84255-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H21N2Se.HI/c1-3-22-14-13-16(17-9-5-6-10-18(17)22)15-21-23(4-2)19-11-7-8-12-20(19)24-21;/h5-15H,3-4H2,1-2H3;1H/q+1;/p-1