84255-12-9 Usage
Benzoate derivative
Contains an aminoethyl group and a dicyanovinyl-phenyl group
Use as a photosensitizer
Commonly used in photodynamic therapy for potential treatment of cancer and other medical conditions
Generation of reactive oxygen species
Ability to generate reactive oxygen species upon exposure to light, leading to destruction of targeted cells
Potential use in organic and electronic applications
Unique chemical structure and properties make it suitable for certain applications in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-12-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84255-12:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*1)+(1*2)=129
129 % 10 = 9
So 84255-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H19N3O2/c1-16(19-9-7-17(8-10-19)13-18(14-22)15-23)24-11-12-26-21(25)20-5-3-2-4-6-20/h2-10,13,16,24H,11-12H2,1H3