84255-24-3 Usage
Uses
Used in Pharmaceutical Industry:
2,5-DIMETHYL-1H-IMIDAZOLE-4-CARBOXYLIC ACID is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drug candidates. Its versatile chemical structure allows for the creation of a wide range of therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical field, 2,5-DIMETHYL-1H-IMIDAZOLE-4-CARBOXYLIC ACID is used as an intermediate in the synthesis of agrochemicals, helping to develop new compounds for agricultural applications such as pesticides and herbicides.
Used in Medicinal Chemistry Research:
2,5-DIMETHYL-1H-IMIDAZOLE-4-CARBOXYLIC ACID is utilized as a key compound in medicinal chemistry research, where its structural flexibility and multiple functional groups enable the exploration of various chemical reactions and the design of innovative pharmaceutical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-24-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84255-24:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*2)+(1*4)=133
133 % 10 = 3
So 84255-24-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2/c1-3-5(6(9)10)8-4(2)7-3/h1-2H3,(H,7,8)(H,9,10)
