84255-39-0 Usage
General Description
2-Phenylimidazole-4-carbodithioic acid is a chemical compound with the molecular formula C10H8N2S2. It is a sulfur-containing heterocyclic compound with a phenyl group attached to an imidazole ring. 2-PHENYLIMIDAZOLE-4-CARBODITHIOIC ACID is primarily used in chemical research and pharmaceutical synthesis. It has been investigated for its potential pharmacological properties, including anti-inflammatory and antioxidant activities. Additionally, it has been studied for its potential role in metal ion chelation and catalytic applications. However, further research is needed to fully elucidate its biological and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-39-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84255-39:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*3)+(1*9)=140
140 % 10 = 0
So 84255-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2S2/c13-10(14)8-6-11-9(12-8)7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14)
