84255-39-0 Usage
Uses
Used in Chemical Research:
2-Phenylimidazole-4-carbodithioic acid is used as a research compound for studying its chemical properties and potential applications in various chemical reactions and processes. Its unique structure allows for exploration of its reactivity and interactions with other molecules.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2-Phenylimidazole-4-carbodithioic acid is utilized as a synthetic intermediate for the development of new drugs. Its potential pharmacological properties, such as anti-inflammatory and antioxidant activities, make it a promising candidate for the creation of novel therapeutic agents.
Used in Anti-inflammatory Applications:
2-Phenylimidazole-4-carbodithioic acid is used as an anti-inflammatory agent due to its potential to modulate inflammatory pathways and reduce inflammation-related symptoms. Further research is needed to fully understand its mechanism of action and optimize its efficacy in treating inflammatory conditions.
Used in Antioxidant Applications:
As an antioxidant, 2-Phenylimidazole-4-carbodithioic acid is used to neutralize free radicals and protect cells from oxidative damage. Its potential antioxidant properties make it a candidate for the development of agents that can combat oxidative stress-related disorders.
Used in Metal Ion Chelation:
2-Phenylimidazole-4-carbodithioic acid is used as a chelating agent for metal ions, which can be important in various industrial and environmental applications. Its ability to form stable complexes with metal ions can help in the removal of toxic metals or the recovery of valuable metals from waste streams.
Used in Catalytic Applications:
In the field of catalysis, 2-Phenylimidazole-4-carbodithioic acid is used as a catalyst or a catalyst precursor to facilitate various chemical reactions. Its unique structure and potential to interact with other molecules make it a candidate for the development of new catalytic systems.
Further research is required to fully elucidate the biological and chemical properties of 2-Phenylimidazole-4-carbodithioic acid, as well as to optimize its applications and maximize its potential in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-39-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84255-39:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*3)+(1*9)=140
140 % 10 = 0
So 84255-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2S2/c13-10(14)8-6-11-9(12-8)7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14)
