84255-50-5 Usage
Chemical structure
1-phenyl-3-(2-phenylpropyl)indan consists of an indane core combined with a phenyl and a 2-phenylpropyl group.
Usage
Commonly used in organic synthesis and medicinal chemistry for the development of various pharmaceuticals and biologically active molecules.
Aromatic properties
Presence of indane and phenyl rings contribute to the molecule's aromatic properties.
Hydrophobic properties
The presence of indane and phenyl rings also contribute to its hydrophobic properties, making it suitable for diverse applications.
Structural features
The unique structure of the compound makes it a potential candidate for the development of new drugs with therapeutic effects.
Versatility
1-phenyl-3-(2-phenylpropyl)indan is a versatile chemical compound with potential applications in the field of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 84255-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,5 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 84255-50:
(7*8)+(6*4)+(5*2)+(4*5)+(3*5)+(2*5)+(1*0)=135
135 % 10 = 5
So 84255-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C24H24/c1-18(19-10-4-2-5-11-19)16-21-17-24(20-12-6-3-7-13-20)23-15-9-8-14-22(21)23/h2-15,18,21,24H,16-17H2,1H3