84282-39-3 Usage
Description
2,6-Dimethyl-4-(1-naphthyl)pyrylium hexafluorophosphate is a heterocyclic chemical compound with a complex structure, consisting of a pyrylium cation and a hexafluorophosphate anion. It features a pyrylium ring with two methyl and one naphthyl substituents, giving it unique molecular properties.
Uses
Used in Organic Synthesis:
2,6-Dimethyl-4-(1-naphthyl)pyrylium hexafluorophosphate is used as a reagent in organic synthesis for its ability to participate in various chemical reactions, contributing to the formation of new compounds.
Used in Fluorescence Spectroscopy and Imaging:
Leveraging its fluorescent properties, 2,6-Dimethyl-4-(1-naphthyl)pyrylium hexafluorophosphate is used as a marker or probe in fluorescence spectroscopy and imaging applications, allowing for the detection and visualization of specific molecules or structures.
Used in Material Development:
Due to its unique molecular structure and properties, 2,6-Dimethyl-4-(1-naphthyl)pyrylium hexafluorophosphate is used as a precursor in the development of new materials, such as dyes and pigments, for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 84282-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,8 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84282-39:
(7*8)+(6*4)+(5*2)+(4*8)+(3*2)+(2*3)+(1*9)=143
143 % 10 = 3
So 84282-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H15O.F6P/c1-12-10-15(11-13(2)18-12)17-9-5-7-14-6-3-4-8-16(14)17;1-7(2,3,4,5)6/h3-11H,1-2H3;/q+1;-1
