84434-34-4 Usage
Molecular structure
2-[2-[2-(4-chlorophenyl)-1-methyl-1H-indol-3-yl]vinyl]-5-(methoxycarbonyl)-1,3,3-trimethyl-3H-indolium iodide consists of a complex structure with various functional groups, including an indolium iodide group, a 4-chlorophenyl group, a 1-methyl-1H-indol-3-yl group, a vinyl group, and a methoxycarbonyl group.
Highly conjugated system
The compound is characterized by its extensive system of double bonds, which allows for the delocalization of electrons and contributes to its stability and chemical properties.
Organic chemistry research
This compound is commonly used in the field of organic chemistry research due to its unique structure and properties.
Specific properties
The properties of 2-[2-[2-(4-chlorophenyl)-1-methyl-1H-indol-3-yl]vinyl]-5-(methoxycarbonyl)-1,3,3-trimethyl-3H-indolium iodide can vary depending on the context and specific application, making it a versatile compound for various studies and experiments.
Potential uses
The potential uses of this compound can also vary depending on its specific properties and the context in which it is being used. Some possible applications may include the development of new materials, pharmaceuticals, or as intermediates in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 84434-34-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,4,3 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84434-34:
(7*8)+(6*4)+(5*4)+(4*3)+(3*4)+(2*3)+(1*4)=134
134 % 10 = 4
So 84434-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C30H28ClN2O2.HI/c1-30(2)24-18-20(29(34)35-5)12-16-26(24)32(3)27(30)17-15-23-22-8-6-7-9-25(22)33(4)28(23)19-10-13-21(31)14-11-19;/h6-18H,1-5H3;1H/q+1;/p-1