84501-72-4 Usage
General Description
Sodium isononanoate is a chemical compound that is derived from isononanoic acid and is used primarily as a surfactant and emulsifier in various industrial and consumer products. It is commonly found in cleaning and personal care products, as well as in agricultural and metalworking applications. As a surfactant, sodium isononanoate helps to lower the surface tension of liquids, allowing them to spread more easily and form stable emulsions. It also serves as a dispersing agent, helping to keep particles suspended in a liquid rather than settling out. Additionally, it can act as a corrosion inhibitor, protecting metal surfaces from degradation. Overall, sodium isononanoate plays a crucial role in enhancing the performance and stability of a wide range of products and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 84501-72-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,5,0 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84501-72:
(7*8)+(6*4)+(5*5)+(4*0)+(3*1)+(2*7)+(1*2)=124
124 % 10 = 4
So 84501-72-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H18O2.Na/c1-8(2)6-4-3-5-7-9(10)11;/h8H,3-7H2,1-2H3,(H,10,11);/q;+1/p-1
