84502-13-6 Usage
General Description
The chemical 1-(4-bromophenyl)-3-[4-[(5-chloro-3H-benzoimidazol-2-yl)methoxy]phenyl ]thiourea, commonly referred to as BCP-I, is a compound with a complex molecular structure. It consists of a thiourea group attached to a phenyl ring with a bromine substitution, connected to another phenyl ring with a 5-chloro-benzoimidazol-2-yl-methoxy substitution. BCP-I is known for its potential biological activities, including anti-inflammatory and anticancer properties. It has been studied for its potential use in the treatment of various diseases and disorders. Additionally, BCP-I may have applications in the field of medicinal chemistry for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 84502-13-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,5,0 and 2 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84502-13:
(7*8)+(6*4)+(5*5)+(4*0)+(3*2)+(2*1)+(1*3)=116
116 % 10 = 6
So 84502-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H16BrClN4OS/c22-13-1-4-15(5-2-13)24-21(29)25-16-6-8-17(9-7-16)28-12-20-26-18-10-3-14(23)11-19(18)27-20/h1-11H,12H2,(H,26,27)(H2,24,25,29)