84512-08-3 Usage
Uses
Used in Pharmaceutical Industry:
4-Piperidine butyric acid hydrochloride is used as a reactant for the synthesis of various pharmaceutical compounds, including NAmPRTase inhibitors and FK866 analogs. These compounds have potential applications in the treatment of various diseases and disorders.
Used in Biochemical Research:
In the field of biochemical research, 4-piperidine butyric acid hydrochloride is used as a reactant for the modification of 3-amidinophenylalanine-derived matriptase inhibitors. Matriptase inhibitors are being studied for their potential role in the regulation of proteolytic processes and their implications in various diseases.
Used in Organic Synthesis:
4-Piperidine butyric acid hydrochloride is also used as a reactant in organic synthesis, particularly in reactions between Weinreb amides and 2-magnesiated oxazoles. This reaction is important for the synthesis of complex organic molecules and the development of new chemical compounds with potential applications in various industries.
Overall, 4-piperidine butyric acid hydrochloride is a versatile compound with applications in the pharmaceutical industry, biochemical research, and organic synthesis. Its unique chemical properties and reactivity make it a valuable component in the development of new drugs, therapeutic agents, and chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 84512-08-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,5,1 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 84512-08:
(7*8)+(6*4)+(5*5)+(4*1)+(3*2)+(2*0)+(1*8)=123
123 % 10 = 3
So 84512-08-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H17NO2.ClH/c11-9(12)3-1-2-8-4-6-10-7-5-8;/h8,10H,1-7H2,(H,11,12);1H
