845305-91-1 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Bromo-N-cyclopentylpicolinamide is utilized as a key building block in the creation of various pharmaceutical compounds. Its unique structure and reactivity contribute to the development of new drugs with specific therapeutic targets.
Used in Coordination Chemistry:
In the field of coordination chemistry, 5-Bromo-N-cyclopentylpicolinamide serves as a ligand, enabling the formation of complex coordination complexes with metal ions. This application is crucial for advancing our understanding of metal-ligand interactions and their implications in various chemical and biological processes.
Used in Neuroscience Research:
5-Bromo-N-cyclopentylpicolinamide is employed in neuroscience research for its potential pharmacological properties. Its ability to interact with specific receptors or pathways in the nervous system makes it a promising candidate for the development of treatments for neurological disorders.
Used in Chemical Research and Development:
5-Bromo-N-cyclopentylpicolinamide is applied in chemical research and development to explore its capacity to form coordination complexes. This research is vital for expanding the knowledge of complex formation and its potential applications in various industries, including materials science and catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 845305-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,5,3,0 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 845305-91:
(8*8)+(7*4)+(6*5)+(5*3)+(4*0)+(3*5)+(2*9)+(1*1)=171
171 % 10 = 1
So 845305-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BrN2O/c12-8-5-6-10(13-7-8)11(15)14-9-3-1-2-4-9/h5-7,9H,1-4H2,(H,14,15)
845305-91-1Relevant academic research and scientific papers
SUBSTITUTED PIPERIDINES AS HISTAMINE H3 RECEPTOR LIGANDS
-
Page/Page column 23, (2010/02/10)
The present invention relates to novel piperidine ether derivatives having affinity for the histamine H3 receptor, processes for their preparation, to compositions containing them and to their use in the treatment of neurological and psychiatric disorders.
