84540-51-2 Usage
Uses
Used in Pharmaceutical Industry:
2,4-dichlor-3-[(isopropylidene)amino]phenol is used as an intermediate in the synthesis of various pharmaceuticals for its potential therapeutic applications. Its antibacterial and anti-inflammatory properties make it a valuable component in the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical industry, 2,4-dichlor-3-[(isopropylidene)amino]phenol is utilized as an intermediate in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Organic Chemistry Research:
As a reagent in organic chemistry, 2,4-dichlor-3-[(isopropylidene)amino]phenol is employed for the preparation of various chemical derivatives. Its unique structure allows for the synthesis of new compounds with potential applications in various fields.
Used in Disease Treatment Research:
2,4-dichlor-3-[(isopropylidene)amino]phenol is studied for its potential use in the treatment of various diseases due to its antibacterial and anti-inflammatory properties. This research aims to explore its therapeutic potential and develop new treatment options.
Check Digit Verification of cas no
The CAS Registry Mumber 84540-51-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,5,4 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84540-51:
(7*8)+(6*4)+(5*5)+(4*4)+(3*0)+(2*5)+(1*1)=132
132 % 10 = 2
So 84540-51-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2NO/c1-5(2)12-9-6(10)3-4-7(13)8(9)11/h3-4,13H,1-2H3
