84605-03-8 Usage
General Description
The chemical "(8S,9S,13S,14S,16R,17R)-13-methyl-2,4-dinitro-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol" is a steroid compound with a complex molecular structure. It contains a cyclopenta[a]phenanthrene core with three hydroxyl groups at positions 3, 16, and 17, as well as two nitro groups at positions 2 and 4. The stereochemistry is defined by the S and R configuration at various positions along the molecule. This chemical may have potential biological activity due to its steroid-like structure and the presence of multiple functional groups, but further research would be needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 84605-03-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,6,0 and 5 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84605-03:
(7*8)+(6*4)+(5*6)+(4*0)+(3*5)+(2*0)+(1*3)=128
128 % 10 = 8
So 84605-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2O7/c1-18-5-4-8-9(12(18)7-14(21)17(18)23)2-3-10-11(8)6-13(19(24)25)16(22)15(10)20(26)27/h6,8-9,12,14,17,21-23H,2-5,7H2,1H3/t8-,9+,12-,14+,17-,18-/m0/s1