84619-63-6 Usage
General Description
The chemical "(2S)-2-amino-N-[(1S)-1-[[(1S)-1-carbamoylethyl]carbamoylmethylcarbamoy l]ethyl]butanediamide" is a complex compound with a molecular formula of C15H28N8O4. This chemical is a dipeptide derivative, containing multiple functional groups, including an amino group, carboxylic acid groups, and an amide group. Its structure consists of a central butanediamide group with additional side chains containing carbamoylmethyl and carbamoylethyl groups. (2S)-2-amino-N-[(1S)-1-[[(1S)-1-carbamoylethyl]carbamoylmethylcarbamoy l]ethyl]butanediamide has potential applications in pharmaceutical research and development due to its unique structure and potential biological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 84619-63-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,6,1 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84619-63:
(7*8)+(6*4)+(5*6)+(4*1)+(3*9)+(2*6)+(1*3)=156
156 % 10 = 6
So 84619-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H22N6O5/c1-5(10(15)21)17-9(20)4-16-11(22)6(2)18-12(23)7(13)3-8(14)19/h5-7H,3-4,13H2,1-2H3,(H2,14,19)(H2,15,21)(H,16,22)(H,17,20)(H,18,23)/t5-,6-,7-/m0/s1