84619-64-7 Usage
General Description
The chemical "(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-carbamoyl-propanoyl]amino]propanoyl]amino]acetyl]amino]propanoyl]amino]-3-carbamoyl-propanoic acid" is a complex molecule composed of multiple amino acids and carboxylic acids. It is a peptide with a total of four amino acid residues and four carbamoyl-propanoyl groups. The chemical structure indicates that it is a highly polar and acidic compound with the potential to form multiple hydrogen bonds and interactions with other molecules. It is likely to exhibit bioactive properties and may be involved in various biochemical processes within biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 84619-64-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,6,1 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84619-64:
(7*8)+(6*4)+(5*6)+(4*1)+(3*9)+(2*6)+(1*4)=157
157 % 10 = 7
So 84619-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H27N7O8/c1-6(22-15(29)8(17)3-10(18)24)13(27)20-5-12(26)21-7(2)14(28)23-9(16(30)31)4-11(19)25/h6-9H,3-5,17H2,1-2H3,(H2,18,24)(H2,19,25)(H,20,27)(H,21,26)(H,22,29)(H,23,28)(H,30,31)/t6-,7-,8-,9-/m0/s1