84696-80-0 Usage
General Description
(Hydroxyethyl)ammonium sodium sulphite is a chemical compound that is commonly used as a reducing agent and antioxidant in various industrial applications. It is a combination of hydroxyethylammonium and sodium sulphite, which gives it the ability to effectively remove oxygen from a system and prevent oxidation reactions from occurring. (Hydroxyethyl)ammonium sodium sulphite is widely used in the food and pharmaceutical industries as a preservative and stabilizer, and it is also utilized in the production of polymers, plastics, and textiles. Additionally, (Hydroxyethyl)ammonium sodium sulphite is known for its ability to inhibit the growth of microorganisms, making it a key ingredient in the preservation of various products. Overall, this chemical compound plays an important role in preserving the quality and shelf life of many different consumer goods.
Check Digit Verification of cas no
The CAS Registry Mumber 84696-80-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,6,9 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 84696-80:
(7*8)+(6*4)+(5*6)+(4*9)+(3*6)+(2*8)+(1*0)=180
180 % 10 = 0
So 84696-80-0 is a valid CAS Registry Number.
InChI:InChI=1/C2H7NO.Na.H2O3S/c1-2(3)4;;1-4(2)3/h2,4H,3H2,1H3;;(H2,1,2,3)/q;+1;/p-1
