84768-09-2 Usage
General Description
The chemical compound "(2S)-1-[(2S)-2-[[4-(2,3-dihydrobenzofuran-2-yl)-1-ethoxycarbonyl-butyl ]amino]propanoyl]pyrrolidine-2-carboxylic acid" is a complex molecule consisting of a pyrrolidine ring structure with various functional groups attached. It is a proline derivative with an amino acid side chain consisting of an ethoxycarbonyl-butyl group and a dihydrobenzofuran-2-yl group. (2S)-1-[(2S)-2-[[4-(2,3-dihydrobenzofuran-2-yl)-1-ethoxycarbonyl-butyl ]amino]propanoyl]pyrrolidine-2-carboxylic acid is likely to have biological activity as a result of its structure, potentially affecting various biological processes. Further research and analysis would be needed to fully understand the characteristics and potential applications of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 84768-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,7,6 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84768-09:
(7*8)+(6*4)+(5*7)+(4*6)+(3*8)+(2*0)+(1*9)=172
172 % 10 = 2
So 84768-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H32N2O6/c1-3-30-23(29)18(10-6-9-17-14-16-8-4-5-12-20(16)31-17)24-15(2)21(26)25-13-7-11-19(25)22(27)28/h4-5,8,12,15,17-19,24H,3,6-7,9-11,13-14H2,1-2H3,(H,27,28)/t15-,17?,18?,19-/m0/s1