84788-07-8 Usage
Description
4-[bis(phenylmethyl)amino]-3-ethoxybenzenediazonium tetrafluoroborate is a diazonium salt with the molecular formula C32H31N4OBF4. It is formed by the reaction of an aromatic amine with nitrous acid and contains a nitroso group (N≡N+). 4-[bis(phenylmethyl)amino]-3-ethoxybenzenediazonium tetrafluoroborate is known for its versatile reactivity in chemical reactions and is commonly used in organic synthesis.
Uses
Used in Organic Synthesis:
4-[bis(phenylmethyl)amino]-3-ethoxybenzenediazonium tetrafluoroborate is used as a reagent for the preparation of various organic compounds, including dyes and pigments. Its tetrafluoroborate salt form makes it stable and easy to handle in laboratory settings, making it an important intermediate in the synthesis of organic molecules.
Used in Chemical Reactions:
Due to its versatile reactivity, 4-[bis(phenylmethyl)amino]-3-ethoxybenzenediazonium tetrafluoroborate is employed in various chemical reactions to facilitate the synthesis of complex organic molecules. Its unique properties allow it to act as a key component in the formation of new chemical bonds and structures.
Check Digit Verification of cas no
The CAS Registry Mumber 84788-07-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,7,8 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 84788-07:
(7*8)+(6*4)+(5*7)+(4*8)+(3*8)+(2*0)+(1*7)=178
178 % 10 = 8
So 84788-07-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H22N3O.BF4/c1-2-26-22-15-20(24-23)13-14-21(22)25(16-18-9-5-3-6-10-18)17-19-11-7-4-8-12-19;2-1(3,4)5/h3-15H,2,16-17H2,1H3;/q+1;-1