847906-27-8 Usage
General Description
3-Iodo-7-Methyl (1H)Indazole is a specialized chemical compound, characterized by the incorporation of iodine and methyl groups into the base indazole molecule. Indazoles are heterocyclic compounds that contain a benzene ring fused to a pyrazole ring. The specific chemical structure of 3-Iodo-7-Methyl (1H)Indazole affords it unique properties that may be useful in various scientific and industrial contexts. However, detailed information on its specific uses, toxicity, or role in chemical reactions is limited and largely depends on the specific context in which it is being applied. As with any chemical, appropriate safety measures should be taken when handling 3-Iodo-7-Methyl (1H)Indazole.
Check Digit Verification of cas no
The CAS Registry Mumber 847906-27-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,7,9,0 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 847906-27:
(8*8)+(7*4)+(6*7)+(5*9)+(4*0)+(3*6)+(2*2)+(1*7)=208
208 % 10 = 8
So 847906-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7IN2/c1-5-3-2-4-6-7(5)10-11-8(6)9/h2-4H,1H3,(H,10,11)
847906-27-8Relevant articles and documents
SMALL MOLECULE ACTIVATORS OF NICOTINAMIDE PHOSPHORIBOSYLTRANSFERASE (NAMPT) AND USES THEREOF
-
Paragraph 01237, (2018/08/03)
Provided herein are small molecule activators of Nicotinamide Phosphoribosyltransferase (NAMPT), compositions comprising the compounds, and methods of using the compounds and compositions.
