84803-62-3 Usage
Uses
Used in Pharmaceutical Industry:
N,N-Dimethyl-2-(propylamino)butyramide is used as a key intermediate in the synthesis of Cropropamide (C815020), a respiratory stimulant. N,N-Dimethyl-2-(propylamino)butyramide plays a crucial role in the development of medications that can help improve respiratory function and treat conditions related to breathing difficulties.
As an intermediate, N,N-Dimethyl-2-(propylamino)butyramide is essential for the production of other pharmaceuticals that may have various therapeutic applications. Its unique structure allows it to be a versatile building block in the synthesis of a range of drugs, potentially contributing to advancements in medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 84803-62-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,8,0 and 3 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84803-62:
(7*8)+(6*4)+(5*8)+(4*0)+(3*3)+(2*6)+(1*2)=143
143 % 10 = 3
So 84803-62-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H20N2O/c1-5-7-10-8(6-2)9(12)11(3)4/h8,10H,5-7H2,1-4H3
