848243-29-8 Usage
Uses
Used in Pharmaceutical Industry:
2-BROMO-3-IODO-ISONICOTINIC ACID is used as a JAK inhibitor for the development of therapeutic agents targeting autoimmune diseases and cancer. Its ability to modulate the Janus kinase (JAK) pathway, which plays a crucial role in cell signaling and immune responses, makes it a promising candidate for treating conditions such as rheumatoid arthritis, psoriasis, and various malignancies. By inhibiting JAK activity, 2-BROMO-3-IODO-ISONICOTINIC ACID can help regulate immune responses and potentially alleviate symptoms associated with these diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 848243-29-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,8,2,4 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 848243-29:
(8*8)+(7*4)+(6*8)+(5*2)+(4*4)+(3*3)+(2*2)+(1*9)=188
188 % 10 = 8
So 848243-29-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrINO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11)
