84878-42-2 Usage
Molecular structure
1-[[[(aminophenyl)methyl]phenyl]amino]-3-phenoxypropan-2-ol is a complex chemical compound with a molecular structure that includes aminophenyl, methyl, phenyl, and phenoxy groups.
Propanol derivative
It is a propanol derivative that contains an amino group and a hydroxyl group.
Potential applications
1-[[[(aminophenyl)methyl]phenyl]amino]-3-phenoxypropan-2-ol could potentially have applications in the pharmaceutical industry due to its diverse functional groups, which may confer biological activity.
Aromatic properties
The presence of aminophenyl and phenyl groups in the molecule suggests that it may have aromatic and potentially reactive properties.
Solubility
The presence of the propanol backbone indicates potential for solubility in organic solvents.
Further research
Further research and analysis are required to fully understand the properties and potential applications of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 84878-42-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,8,7 and 8 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84878-42:
(7*8)+(6*4)+(5*8)+(4*7)+(3*8)+(2*4)+(1*2)=182
182 % 10 = 2
So 84878-42-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H24N2O2/c23-21-12-6-4-8-17(21)14-18-9-5-7-13-22(18)24-15-19(25)16-26-20-10-2-1-3-11-20/h1-13,19,24-25H,14-16,23H2