849020-92-4 Usage
Uses
Used in Pharmaceutical Applications:
2-Carbomethoxybenzylamine hydrochloride is used as a pharmaceutical agent for its potential analgesic and anti-inflammatory effects. Its ability to alleviate pain and reduce inflammation can be beneficial in the treatment of various conditions and diseases.
Used in Research Applications:
In the research field, 2-Carbomethoxybenzylamine hydrochloride serves as a valuable compound for studying its potential pharmaceutical properties and exploring its mechanisms of action. This can contribute to the development of new drugs and therapies.
Used in Organic Synthesis:
2-Carbomethoxybenzylamine hydrochloride is used as a precursor in organic synthesis, allowing for the production of other compounds with various applications. Its unique structure and functional groups make it a useful building block in the synthesis of complex organic molecules.
Used in Industrial Applications:
In industrial settings, 2-Carbomethoxybenzylamine hydrochloride may find use in the development of new materials, catalysts, or other chemical products. Its versatility and potential for modification make it a valuable component in various industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 849020-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,2 and 0 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 849020-92:
(8*8)+(7*4)+(6*9)+(5*0)+(4*2)+(3*0)+(2*9)+(1*2)=174
174 % 10 = 4
So 849020-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2.ClH/c1-12-9(11)8-5-3-2-4-7(8)6-10;/h2-5H,6,10H2,1H3;1H
849020-92-4Relevant academic research and scientific papers
Phenylglycinamide and pyridylglycinamide derivatives useful as anticoagulants
-
Page/Page column 52, (2010/11/25)
The present invention provides novel phenylglycinamide derivatives of Formula (I) or (IV): or a stereoisomer, tautomer, pharmaceutically acceptable salt, solvate, or prodrug thereof, wherein the variables W, W1, Y, Z, R7, R8, R9, and R11 are as defined herein. These compounds are selective inhibitors of factor VIIa which can be used as medicaments.
