849052-19-3 Usage
Uses
Used in Organic Synthesis:
2-Bromo-3-ethoxy-6-fluorophenylboronic acid is utilized as a building block in organic synthesis for constructing complex organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of various organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Bromo-3-ethoxy-6-fluorophenylboronic acid is used as a precursor in the development of drugs and pharmaceutical intermediates. The incorporation of boronic acid structures can enhance the pharmacological properties of drug candidates, potentially leading to improved therapeutic agents.
Used in Medicinal Chemistry:
2-Bromo-3-ethoxy-6-fluorophenylboronic acid is employed in medicinal chemistry to explore the effects of the fluorine substituent on the phenyl ring. The presence of fluorine can influence the molecule's lipophilicity, metabolic stability, and binding affinity, which are critical factors in drug design and optimization.
Used in Material Science:
In material science, 2-Bromo-3-ethoxy-6-fluorophenylboronic acid may be used to investigate the impact of its structural features on material properties. The integration of such molecules into materials could lead to advancements in areas such as polymer chemistry, where their unique interactions with other molecules could be harnessed for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 849052-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,5 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 849052-19:
(8*8)+(7*4)+(6*9)+(5*0)+(4*5)+(3*2)+(2*1)+(1*9)=183
183 % 10 = 3
So 849052-19-3 is a valid CAS Registry Number.
InChI:InChI=1S/C8H9BBrFO3/c1-2-14-6-4-3-5(11)7(8(6)10)9(12)13/h3-4,12-13H,2H2,1H3
