849062-04-0 Usage
Uses
Used in Pharmaceutical Industry:
2,6-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC & is used as a reagent in the synthesis of complex organic molecules for the development of new pharmaceuticals. Its unique structure allows for the formation of carbon-carbon bonds through cross-coupling reactions, which is crucial in the creation of novel drug candidates.
Used in Agrochemical Industry:
2,6-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC & is used as a building block in the synthesis of agrochemicals, contributing to the development of new pesticides and other agricultural products. Its versatility in organic synthesis enables the creation of molecules with desired properties for effective pest control and crop protection.
Used in Materials Science:
2,6-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC & is used as a reagent in the synthesis of advanced materials, such as polymers and composites, with tailored properties for various applications. Its ability to form carbon-carbon bonds through cross-coupling reactions allows for the development of materials with improved performance characteristics, such as enhanced strength, durability, or conductivity.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 849062-04:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*0)+(1*4)=180
180 % 10 = 0
So 849062-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BF2O3/c1-5(2)15-7-4-3-6(11)8(9(7)12)10(13)14/h3-5,13-14H,1-2H3
