849062-09-5 Usage
Uses
Used in Organic Synthesis:
2,6-Difluoro-3-formylphenylboronic acid is used as a reagent in organic synthesis for the construction of carbon-carbon and carbon-heteroatom bonds. Its unique structure allows for the formation of stable intermediates and facilitates the synthesis of complex organic molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2,6-difluoro-3-formylphenylboronic acid is utilized in the development of new drugs. Its ability to form stable bonds with various functional groups makes it a valuable building block for the synthesis of bioactive compounds with potential therapeutic applications.
Used in Agrochemical Development:
2,6-Difluoro-3-formylphenylboronic acid is also employed in the development of agrochemicals, such as pesticides and herbicides. Its reactivity and compatibility with other chemical groups enable the creation of novel agrochemicals with improved efficacy and selectivity.
Used as a Fluorescent Probe in Research:
2,6-Difluoro-3-formylphenylboronic acid has demonstrated potential as a fluorescent probe for detecting and imaging specific cellular structures and processes. Its unique optical properties allow for the visualization of biological events at the molecular level, contributing to a better understanding of cellular mechanisms and the development of targeted therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-09-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 849062-09:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*0)+(1*9)=185
185 % 10 = 5
So 849062-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BF2O3/c9-5-2-1-4(3-11)7(10)6(5)8(12)13/h1-3,12-13H
