849062-18-6 Usage
Uses
Used in Organic Synthesis:
3-BROMO-2-(2'-FLUOROBENZYLOXY)-5-METHYL& is used as a synthetic intermediate for the preparation of various organic compounds. Its unique molecular structure allows for versatile chemical reactions, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-BROMO-2-(2'-FLUOROBENZYLOXY)-5-METHYL& is used as a key component in the development of new drugs. Its unique molecular structure can be utilized to design and synthesize novel pharmaceutical agents with potential therapeutic applications.
Used in Material Science:
3-BROMO-2-(2'-FLUOROBENZYLOXY)-5-METHYL& is used as a functional component in the development of advanced materials. Its unique properties, such as the presence of a bromine atom, a fluorine atom, and an ether functional group, can contribute to the creation of materials with specific characteristics, such as improved stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-18-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 849062-18:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*1)+(1*8)=186
186 % 10 = 6
So 849062-18-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BBrFO3/c1-9-6-11(15(18)19)14(12(16)7-9)20-8-10-4-2-3-5-13(10)17/h2-7,18-19H,8H2,1H3
