849062-23-3 Usage
Uses
Used in Pharmaceutical Research and Development:
3-Bromo-5-methyl-2-(3'-methoxybenzyloxy)pyridine is utilized as a building block in the synthesis of biologically active compounds, playing a crucial role in the creation of new pharmaceutical entities. Its unique structure allows for the development of molecules with specific therapeutic properties.
Used in Agrochemical Production:
In the agrochemical industry, 3-Bromo-5-methyl-2-(3'-methoxybenzyloxy)pyridine is employed as an intermediate in the production process, contributing to the formulation of effective agrochemicals designed to protect crops and enhance agricultural productivity.
Used in Chemical Research:
3-Bromo-5-methyl-2-(3'-methoxybenzyloxy)pyridine is also valuable in chemical research, where it can be used to explore new reactions and mechanisms, potentially leading to the discovery of novel chemical processes or materials.
Used in Drug Development:
Due to its potential biological activity, 3-Bromo-5-methyl-2-(3'-methoxybenzyloxy)pyridine may be instrumental in the development of new drugs, particularly those targeting specific diseases or conditions where existing treatments are insufficient or lacking.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-23-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 849062-23:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*2)+(1*3)=183
183 % 10 = 3
So 849062-23-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H16BBrO4/c1-10-6-13(16(18)19)15(14(17)7-10)21-9-11-4-3-5-12(8-11)20-2/h3-8,18-19H,9H2,1-2H3
