849062-29-9 Usage
Uses
Used in Organic Synthesis:
5-CHLORO-2-PROPOXYPHENYLBORONIC ACID is used as a building block in organic synthesis for the creation of various biologically active molecules. Its unique structure allows for the formation of new chemical entities that can be further utilized in different applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-CHLORO-2-PROPOXYPHENYLBORONIC ACID is employed as a key component in the synthesis of pharmaceuticals. Its presence in the molecular structure can contribute to the development of new drugs with potential therapeutic benefits.
Used in Suzuki Coupling Reactions:
5-CHLORO-2-PROPOXYPHENYLBORONIC ACID is utilized as a reagent in Suzuki coupling reactions, which are cross-coupling processes used to form carbon-carbon bonds. This application is significant in the synthesis of complex organic molecules and the development of new materials.
Used in the Development of New Materials:
The versatility of 5-CHLORO-2-PROPOXYPHENYLBORONIC ACID makes it suitable for the development of new materials with unique properties. Its structural features can be exploited to create materials with potential applications in various industries.
Used in Pharmaceutical Industry:
5-CHLORO-2-PROPOXYPHENYLBORONIC ACID is used as a key intermediate in the pharmaceutical industry for the synthesis of drugs with specific therapeutic targets. Its incorporation into drug molecules can enhance their efficacy and selectivity, leading to improved treatment options for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-29-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 849062-29:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*2)+(1*9)=189
189 % 10 = 9
So 849062-29-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BClO3/c1-2-5-14-9-4-3-7(11)6-8(9)10(12)13/h3-4,6,12-13H,2,5H2,1H3
