849062-34-6 Usage
Uses
Used in Organic Synthesis:
2-Bromo-4,5-difluorophenylboronic acid is used as a reagent in organic synthesis for the formation of stable bonds with diols. Its unique structure and properties make it a valuable building block in the creation of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-Bromo-4,5-difluorophenylboronic acid is used as a key intermediate in the development of new drugs. Its ability to form stable bonds with diols allows for the synthesis of a wide range of pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Development:
2-Bromo-4,5-difluorophenylboronic acid is also utilized in the development of agrochemicals, where its unique structure and properties contribute to the creation of effective and environmentally friendly products for agricultural use.
Overall, 2-Bromo-4,5-difluorophenylboronic acid is an important reagent in the field of organic chemistry, with great potential for further research and development in various industries, including pharmaceuticals and agrochemicals. Its unique structure and properties make it a valuable tool for the synthesis of complex organic molecules and the development of new drugs and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-34-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 849062-34:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*3)+(1*4)=186
186 % 10 = 6
So 849062-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BBrF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2,11-12H
