849062-37-9 Usage
Uses
Used in Organic Synthesis:
3-Bromo-5-fluorophenylboronic acid is used as a reactant for the preparation of functionalized dihalophenylboronic acids. It serves as a key intermediate in the synthesis of complex organic molecules and pharmaceutical compounds, providing a convenient route to access diverse chemical structures with potential applications in various fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Bromo-5-fluorophenylboronic acid is used as a building block for the development of new drugs. Its unique structure allows for the creation of novel compounds with specific biological activities, potentially leading to the discovery of new therapeutic agents for the treatment of various diseases.
Used in Material Science:
3-Bromo-5-fluorophenylboronic acid is also utilized in material science for the synthesis of functional materials with tailored properties. Its reactivity and structural features enable the design of new materials with improved performance in areas such as electronics, optoelectronics, and energy storage.
Used in Chemical Research:
In chemical research, 3-Bromo-5-fluorophenylboronic acid is employed as a model compound to study various reaction mechanisms and explore new synthetic methodologies. Its unique reactivity allows researchers to gain insights into the fundamental aspects of organic chemistry and develop innovative strategies for the synthesis of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 849062-37-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 849062-37:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*2)+(2*3)+(1*7)=189
189 % 10 = 9
So 849062-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BBrFO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H
849062-37-9Relevant articles and documents
ALKYNYL ALCOHOLS AND METHODS OF USE
-
Page/Page column 160; 161, (2015/03/13)
The invention relates to compounds of Formula (0): wherein Q, A1-A8, R4 and R5 and each has the meaning as described herein. Compounds of Formula (0) and pharmaceutical compositions thereof are useful in the treatment of diseases and disorders in which undesired or over- activation of NF-kB signaling is observed.