849600-64-2 Usage
Uses
Used in Oncology:
1-METHYL-1H-IMIDAZOLE-2-CARBOXAMIDINE HCL is used as an anti-cancer agent for its potential to treat various types of cancer, including leukemia and solid tumors. It targets the ornithine decarboxylase enzyme, which plays a role in cell proliferation, and has shown promise in inhibiting tumor growth and progression.
Used in Antiviral Applications:
1-METHYL-1H-IMIDAZOLE-2-CARBOXAMIDINE HCL is used as an anti-viral agent due to its potential to inhibit viral replication and reduce the severity of viral infections.
Used in Anti-inflammatory Applications:
1-METHYL-1H-IMIDAZOLE-2-CARBOXAMIDINE HCL is used as an anti-inflammatory agent for its potential to reduce inflammation and alleviate symptoms associated with inflammatory conditions.
Used in Pharmaceutical Industry:
1-METHYL-1H-IMIDAZOLE-2-CARBOXAMIDINE HCL is used as a potential therapeutic agent in the development of new drugs for various medical conditions, including cancer, viral infections, and inflammatory diseases. Its unique chemical properties and potential for targeted enzyme inhibition make it a promising candidate for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 849600-64-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,6,0 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 849600-64:
(8*8)+(7*4)+(6*9)+(5*6)+(4*0)+(3*0)+(2*6)+(1*4)=192
192 % 10 = 2
So 849600-64-2 is a valid CAS Registry Number.
InChI:InChI=1S/C5H8N4.ClH/c1-9-3-2-8-5(9)4(6)7;/h2-3H,1H3,(H3,6,7);1H
