849818-29-7

Usage

Uses

Used in Pesticide Production:
Benzene, 1-(2-chloroethyl)-4-octylis utilized as an active ingredient in the formulation of pesticides, specifically for its ability to control and eliminate pests that can damage crops and affect agricultural productivity. Its chemical structure allows it to target and disrupt the biological processes of pests, leading to their death.
Used in Insecticide Formulation:
In the realm of insecticides, Benzene, 1-(2-chloroethyl)-4-octylserves as a key component, leveraging its toxic nature to eliminate insects that pose threats to human health or interfere with the ecosystem balance. Its effectiveness in insect control makes it a valuable tool in integrated pest management strategies.
Used in Pharmaceutical Manufacturing:
Benzene, 1-(2-chloroethyl)-4-octylalso finds application in the pharmaceutical industry, where it may be employed as a chemical intermediate in the synthesis of various medicinal compounds. Its unique structure can be manipulated to create new drugs with specific therapeutic properties.
Used in Chemical Intermediates:
As a chemical intermediate, Benzene, 1-(2-chloroethyl)-4-octylplays a crucial role in the synthesis of a wide range of chemical products. Its versatility in chemical reactions allows it to be a building block for the development of new materials and compounds with diverse applications.
Used in Chemical Research:
In the field of chemical research, Benzene, 1-(2-chloroethyl)-4-octylis used as a subject of study to understand its properties, reactivity, and potential applications. Researchers explore its behavior in various chemical reactions and its interactions with other compounds to expand the knowledge base of organic chemistry.

InChI:InChI=1S/C16H25Cl/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)13-14-17/h9-12H,2-8,13-14H2,1H3