849936-29-4 Usage
Appearance
Yellow crystalline solid 2-(3,4-DICHLOROPHENYL)MALONDIALDEHYDE has a yellow color and a crystalline structure, which gives it a solid form with a well-defined geometry.
Derivation
Derived from malondialdehyde and 3,4-dichlorophenylhydrazine The synthesis of 2-(3,4-DICHLOROPHENYL)MALONDIALDEHYDE involves the reaction of malondialdehyde with 3,4-dichlorophenylhydrazine, resulting in the formation of the desired product.
Use as a reagent
Commonly used in organic synthesis 2-(3,4-dichlorophenyl)malondialdehyde is a popular reagent in organic chemistry due to its unique properties and reactivity.
Preparation of heterocyclic compounds
Can be used in the preparation of various heterocyclic compounds 2-(3,4-DICHLOROPHENYL)MALONDIALDEHYDE serves as a valuable building block in the synthesis of a wide range of heterocyclic compounds, which are important in pharmaceuticals, agrochemicals, and other applications.
Reactivity with nucleophiles
Known for its ability to react with a wide range of nucleophiles The presence of the electrophilic carbonyl groups in the molecule allows it to react with various nucleophiles, making it a versatile reagent in organic synthesis.
Formation of carbon-carbon and carbon-heteroatom bonds
Useful in the formation of new carbon-carbon and carbon-heteroatom bonds The reactivity of 2-(3,4-dichlorophenyl)malondialdehyde with nucleophiles enables the formation of new bonds, which is crucial in the synthesis of complex organic molecules.
Value in research and development
A valuable tool in organic chemistry research and development The unique structure and reactivity of 2-(3,4-dichlorophenyl)malondialdehyde make it an important compound for the development of new synthetic methods and the discovery of novel chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 849936-29-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,9,3 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 849936-29:
(8*8)+(7*4)+(6*9)+(5*9)+(4*3)+(3*6)+(2*2)+(1*9)=234
234 % 10 = 4
So 849936-29-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H6Cl2O2/c10-8-2-1-6(3-9(8)11)7(4-12)5-13/h1-5,7H
