85005-71-6 Usage
Molecular structure
A complex organic compound with a benzothiazolium core, a butyl(2-cyanoethyl)amino substituent on one side, a phenylazo group on the other side, a methoxy group, and a methyl group.
Counter ion
Acetate molecule is added as the counter ion, making it a salt.
Chemical classification
Heterocyclic compound, containing both nitrogen and sulfur atoms in its structure.
Potential applications
Possible uses in pharmaceuticals, dyes, and materials science industries due to its unique structure and properties.
Physical state
Likely a solid at room temperature, as most organic salts are not volatile.
Solubility
May be soluble in polar solvents such as water, methanol, or acetone, due to the presence of polar functional groups (e.g., cyano, amino, and acetate).
Stability
The compound's stability may be influenced by factors such as temperature, light exposure, and the presence of other chemicals. Proper storage conditions should be maintained to ensure its stability.
Reactivity
The presence of various functional groups (e.g., cyano, amino, and methoxy) may make the compound reactive with certain reagents or under specific conditions. Care should be taken when handling or using the compound in chemical reactions.
Color
The color of the compound is not specified in the provided material, but the presence of the phenylazo group may impart a color to the compound, depending on its electronic structure.
Spectroscopic properties
The compound's unique structure may result in distinct spectroscopic signatures, such as UV-Vis, NMR, or IR spectra, which can be used for identification and characterization purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 85005-71-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,0 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 85005-71:
(7*8)+(6*5)+(5*0)+(4*0)+(3*5)+(2*7)+(1*1)=116
116 % 10 = 6
So 85005-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N5OS.C2H4O2/c1-4-5-14-27(15-6-13-23)18-9-7-17(8-10-18)24-25-22-26(2)20-12-11-19(28-3)16-21(20)29-22;1-2(3)4/h7-12,16H,4-6,14-15H2,1-3H3;1H3,(H,3,4)/q+1;/p-1