850080-86-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-5-methylpyridine-4-carboxylic acid ethyl ester is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows for the creation of molecules with specific therapeutic properties, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-5-methylpyridine-4-carboxylic acid ethyl ester is utilized as a precursor in the production of pesticides and other agrochemicals. Its role in these applications is to provide a structural foundation for the creation of compounds that can effectively control pests and diseases in agriculture.
Used in Research and Development:
2-Chloro-5-methylpyridine-4-carboxylic acid ethyl ester is also used in research and development activities, where it serves as a key component in the exploration of new chemical reactions and the synthesis of novel organic compounds. Its presence in these processes aids scientists in understanding the reactivity and potential applications of newly synthesized molecules.
It is crucial to handle 2-Chloro-5-methylpyridine-4-carboxylic acid ethyl ester with care due to its potential health and environmental risks if mismanaged. Proper safety measures should be implemented during its production, use, and disposal to mitigate any adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 850080-86-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,0,8 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 850080-86:
(8*8)+(7*5)+(6*0)+(5*0)+(4*8)+(3*0)+(2*8)+(1*6)=153
153 % 10 = 3
So 850080-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO2/c1-3-13-9(12)7-4-8(10)11-5-6(7)2/h4-5H,3H2,1-2H3
