850375-06-3 Usage
Uses
Used in Pharmaceutical Industry:
[3-(2-METHYL-1,3-THIAZOL-4-YL)PHENYL]METHANOL is used as a pharmaceutical compound for its potential to exhibit various biological activities. Its unique chemical structure allows it to be involved in drug development projects, where it can be utilized to create new drugs with specific therapeutic effects.
Used in Drug Research and Development:
In the field of drug research and development, [3-(2-METHYL-1,3-THIAZOL-4-YL)PHENYL]METHANOL serves as a valuable component. Its presence in various projects is attributed to its capacity to contribute to the discovery and creation of novel drugs with potential medicinal properties.
Used as a Building Block in Organic Synthesis:
[3-(2-METHYL-1,3-THIAZOL-4-YL)PHENYL]METHANOL also finds application as a building block in organic synthesis. It can be used to construct more complex molecules, which can then be applied across different industries, particularly in pharmaceutical and biotechnology sectors, to develop innovative products and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 850375-06-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,3,7 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 850375-06:
(8*8)+(7*5)+(6*0)+(5*3)+(4*7)+(3*5)+(2*0)+(1*6)=163
163 % 10 = 3
So 850375-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NOS/c1-8-12-11(7-14-8)10-4-2-3-9(5-10)6-13/h2-5,7,13H,6H2,1H3
