850375-06-3 Usage
General Description
[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanol is a chemical compound with a molecular formula C11H11NOS. It is a phenyl methanol derivative containing a thiazole ring. [3-(2-METHYL-1,3-THIAZOL-4-YL)PHENYL]METHANOL is often used in the field of pharmaceuticals and can be found in various drug development projects. It is also used in the research and development of new drugs, as it has the potential to exhibit various biological activities due to its unique chemical structure. Additionally, it can also be used as a building block in organic synthesis to create more complex molecules for various applications in the pharmaceutical and biotechnology industries.
Check Digit Verification of cas no
The CAS Registry Mumber 850375-06-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,3,7 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 850375-06:
(8*8)+(7*5)+(6*0)+(5*3)+(4*7)+(3*5)+(2*0)+(1*6)=163
163 % 10 = 3
So 850375-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NOS/c1-8-12-11(7-14-8)10-4-2-3-9(5-10)6-13/h2-5,7,13H,6H2,1H3