850429-64-0 Usage
Uses
Used in Chemical Research:
4,5-Difluorooxindole is utilized as a chemical intermediate for the synthesis of various organic compounds, taking advantage of its enhanced reactivity and stability. Its unique structure and fluorine substitution make it a valuable candidate for exploring new synthetic pathways and reactions in organic chemistry.
Used in Pharmaceutical Development:
Given its potential reactivity and stability, 4,5-difluorooxindole may serve as a building block in the design and synthesis of novel pharmaceutical compounds. Its unique properties could contribute to the development of new drugs with improved pharmacokinetic and pharmacodynamic profiles.
Used in Material Science:
The electronegative nature of fluorine in 4,5-difluorooxindole could be leveraged in the development of advanced materials with specific properties, such as high thermal stability, chemical resistance, or unique electronic characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 850429-64-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,4,2 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 850429-64:
(8*8)+(7*5)+(6*0)+(5*4)+(4*2)+(3*9)+(2*6)+(1*4)=170
170 % 10 = 0
So 850429-64-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F2NO/c9-5-1-2-6-4(8(5)10)3-7(12)11-6/h1-2H,3H2,(H,11,12)
