85050-06-2 Usage
Molecular structure
2-[[5-[4-(methoxycarbonyl)phenyl]-3-methyl-1,3,4-thiadiazol-2(3H)-ylidene]methyl]-1-methylquinolinium methyl sulphate is a complex organic compound consisting of a quinolinium group, a methyl sulphate group, and a 1,3,4-thiadiazol-2(3H)-ylidene group, along with a methoxycarbonylphenyl group.
Quinolinium group
A positively charged, aromatic compound found in various drugs, which may indicate potential pharmaceutical applications.
Methyl sulphate group
A methanesulfonic acid derivative that can provide stability and solubility to the compound.
1,3,4-Thiadiazol-2(3H)-ylidene group
A heterocyclic compound known for its antimicrobial, antifungal, and antiviral properties, suggesting that the compound may have biological activity.
Methoxycarbonylphenyl group
An aromatic compound with an ether functional group, which can influence the compound's reactivity, stability, and solubility.
Potential applications
Due to the presence of the quinolinium group and the 1,3,4-thiadiazol-2(3H)-ylidene group, the compound may have potential uses in pharmaceuticals and as a biologically active agent. However, further research and testing are needed to determine its specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85050-06-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,5 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85050-06:
(7*8)+(6*5)+(5*0)+(4*5)+(3*0)+(2*0)+(1*6)=112
112 % 10 = 2
So 85050-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H20N3O2S.CH4O4S/c1-24-18(13-12-15-6-4-5-7-19(15)24)14-20-25(2)23-21(28-20)16-8-10-17(11-9-16)22(26)27-3;1-5-6(2,3)4/h4-14H,1-3H3;1H3,(H,2,3,4)/q+1;/p-1