850567-22-5 Usage
Uses
Used in Pharmaceutical Synthesis:
Boronic acid, B-[3-[(propylamino)carbonyl]phenyl]is used as a reagent in the synthesis of potential drugs and pharmaceuticals. Its ability to selectively form C-C bonds makes it a valuable tool in the development of new and innovative medications.
Used in Material Science:
In the field of material science, Boronic acid, B-[3-[(propylamino)carbonyl]phenyl]is used in the development of new materials and technologies. Its unique chemical properties allow it to be incorporated into various materials, enhancing their performance and functionality.
Used in Medical Imaging:
Boronic acid, B-[3-[(propylamino)carbonyl]phenyl]has been studied for its potential use in medical imaging. Its ability to selectively bind to certain biological targets makes it a promising candidate for the development of imaging agents that can provide detailed insights into the structure and function of biological systems.
Used in Cancer Therapy:
In the field of cancer therapy, Boronic acid, B-[3-[(propylamino)carbonyl]phenyl]has been investigated for its potential use in the treatment of various types of cancer. Its unique chemical properties may allow it to selectively target cancer cells, leading to the development of more effective and targeted cancer therapies.
Used in Organic Chemistry Research:
Boronic acid, B-[3-[(propylamino)carbonyl]phenyl]is also used in organic chemistry research to explore new synthetic pathways and develop innovative chemical reactions. Its unique structure and reactivity make it an important compound for advancing the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-22-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 850567-22:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*2)+(1*2)=175
175 % 10 = 5
So 850567-22-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO3/c1-2-6-12-10(13)8-4-3-5-9(7-8)11(14)15/h3-5,7,14-15H,2,6H2,1H3,(H,12,13)
