850567-26-9 Usage
Uses
Used in Chemical Synthesis:
3-(Methoxycarbamoyl)Phenylboronic Acid is used as a reagent for the creation of new compounds, taking advantage of its ability to form stable complexes with other molecules. This property makes it a useful tool in the synthesis process.
Used in Catalyst Development:
3-(METHOXYCARBAMOYL)PHENYLBORONIC ACID's specific properties enable it to act as a catalyst, facilitating chemical reactions and improving the efficiency of various processes in the chemical industry.
Used in Molecular Recognition:
3-(Methoxycarbamoyl)Phenylboronic Acid can support molecular recognition processes, which is crucial in fields such as drug discovery and development, where the ability to identify and bind to specific molecular targets is essential.
Used in the Construction of Complex Molecules:
3-(METHOXYCARBAMOYL)PHENYLBORONIC ACID serves as a building block in the assembly of more complex molecules, contributing to the advancement of materials science and the development of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-26-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 850567-26:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*2)+(1*6)=179
179 % 10 = 9
So 850567-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BNO4/c1-14-10-8(11)6-3-2-4-7(5-6)9(12)13/h2-5,12-13H,1H3,(H,10,11)
