850567-29-2 Usage
Uses
Used in Organic Synthesis:
(3-Allylamino carbonyl)benzeneboronic acid is used as a key intermediate for the synthesis of complex organic molecules, playing a crucial role in the development of new chemical entities with potential applications across various industries.
Used in Medicinal Chemistry:
In the pharmaceutical industry, (3-Allylamino carbonyl)benzeneboronic acid is utilized as a reagent in the synthesis of biologically active compounds, contributing to the discovery of new drugs with therapeutic potential.
Used as a Reagent in Suzuki-Miyaura Coupling Reactions:
(3-Allylamino carbonyl)benzeneboronic acid is employed as a reagent in Suzuki-Miyaura coupling reactions, a widely used method in organic chemistry for the formation of carbon-carbon bonds, particularly in the synthesis of complex organic molecules.
Used in Therapeutic Agent Development:
(3-Allylamino carbonyl)benzeneboronic acid has been explored for its potential as a therapeutic agent in the treatment of various diseases, such as cancer and diabetes. Its ability to interact with specific biological targets and modulate their activity makes it a promising candidate for further research and development in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-29-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 850567-29:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*2)+(1*9)=182
182 % 10 = 2
So 850567-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BNO3/c1-2-6-12-10(13)8-4-3-5-9(7-8)11(14)15/h2-5,7,14-15H,1,6H2,(H,12,13)
