850567-33-8 Usage
Uses
Used in Organic Synthesis:
3-(2-Methoxyethylaminocarbonyl)benzeneboronic acid is used as a reagent in organic synthesis for its ability to participate in Suzuki-Miyaura cross-coupling reactions, which are crucial for the formation of carbon-carbon bonds. This application is vital for constructing complex organic molecules and advancing the synthesis of pharmaceutical compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(2-Methoxyethylaminocarbonyl)benzeneboronic acid is employed as a key intermediate in the development of pharmaceuticals. Its unique structure allows for the creation of new drug candidates with potential therapeutic properties, contributing to the discovery of novel treatments for various diseases.
Used as a Biological Probe in Chemical Biology:
3-(2-Methoxyethylaminocarbonyl)benzeneboronic acid is utilized as a biological probe for detecting and investigating specific biological processes. Its ability to modulate the activity of certain enzymes and receptors makes it a valuable tool for researchers seeking to understand and manipulate biological systems at the molecular level.
Used in Pharmaceutical Development:
3-(2-METHOXYETHYLAMINOCARBONYL)BENZENEBORONIC ACID is also used in the development of pharmaceuticals, where its potential therapeutic properties are explored. Its capacity to interact with biological targets, such as enzymes and receptors, positions it as a promising candidate for the creation of new drugs with specific therapeutic effects.
Used in Enzyme and Receptor Modulation Research:
3-(2-Methoxyethylaminocarbonyl)benzeneboronic acid is employed in research aimed at modulating the activity of enzymes and receptors. Its interaction with these biological targets can provide insights into their function and regulation, which is essential for the development of targeted therapies and understanding disease mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-33-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 850567-33:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*3)+(1*3)=178
178 % 10 = 8
So 850567-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO4/c1-16-6-5-12-10(13)8-3-2-4-9(7-8)11(14)15/h2-4,7,14-15H,5-6H2,1H3,(H,12,13)
