850567-34-9 Usage
Uses
Used in Organic Synthesis:
3-(2-Thiazolyl)aminocarbonylphenylboronic acid is used as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds, facilitating the synthesis of complex organic molecules and contributing to the advancement of chemical research and development.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3-(2-Thiazolyl)aminocarbonylphenylboronic acid is utilized as a potential ligand in catalytic reactions, playing a crucial role in the development of new drugs and pharmaceuticals. Its unique properties may contribute to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in the Study of Biological Systems:
3-(2-Thiazolyl)aminocarbonylphenylboronic acid is employed in research to investigate the effects of boron-containing compounds on biological systems. This research may lead to a better understanding of the role of boron in biological processes and the identification of potential applications in the treatment of certain diseases.
Overall, 3-(2-Thiazolyl)aminocarbonylphenylboronic acid is a multifaceted chemical entity with significant potential in various scientific and industrial applications, particularly in the fields of organic synthesis, pharmaceutical development, and biological research.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-34-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 850567-34:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*3)+(1*4)=179
179 % 10 = 9
So 850567-34-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BN2O3S/c14-9(13-10-12-4-5-17-10)7-2-1-3-8(6-7)11(15)16/h1-6,15-16H,(H,12,13,14)
