850567-35-0 Usage
Uses
Used in Organic Synthesis:
3-(4-FLUOROPHENYL)AMINOCARBONYLPHENYLBORONIC ACID is used as a reagent in the Suzuki-Miyaura cross-coupling reaction for the formation of carbon-carbon bonds, which is crucial in the synthesis of complex organic molecules.
Used in Pharmaceutical Preparation:
In the Pharmaceutical Industry, 3-(4-FLUOROPHENYL)AMINOCARBONYLPHENYLBORONIC ACID is used as a key intermediate in the preparation of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Development:
3-(4-FLUOROPHENYL)AMINOCARBONYLPHENYLBORONIC ACID is utilized as a building block in the creation of agrochemicals, contributing to the development of effective and targeted pesticides or other agricultural chemicals.
Used in Materials Science:
In the Materials Science field, 3-(4-FLUOROPHENYL)AMINOCARBONYLPHENYLBORONIC ACID is employed in the synthesis of new materials with tailored properties, such as improved conductivity, stability, or specific interactions with biological systems.
Used in Biological and Environmental Studies:
3-(4-FLUOROPHENYL)AMINOCARBONYLPHENYLBORONIC ACID is used as a selective binding agent for diols or other Lewis bases, making it a useful tool in studying biological interactions and environmental processes.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-35-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 850567-35:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*3)+(1*5)=180
180 % 10 = 0
So 850567-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H11BFNO3/c15-11-4-6-12(7-5-11)16-13(17)9-2-1-3-10(8-9)14(18)19/h1-8,18-19H,(H,16,17)
