850567-38-3 Usage
Uses
Used in Organic Synthesis:
3-(1H-tetrazol-5-yl-carbamoyl)benzenboronic acid, HCl, is used as a versatile reagent in organic synthesis for its ability to form stable bonds with hydroxyl groups. This property allows for the creation of a wide range of chemical compounds, expanding the scope of chemical reactions and products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-(1H-tetrazol-5-yl-carbamoyl)benzenboronic acid, HCl, is employed as a key intermediate in the development of new drugs. Its unique structure and reactivity make it a promising candidate for the synthesis of bioactive molecules with potential therapeutic applications.
Used in Suzuki-Miyaura Couplings:
3-(1H-tetrazol-5-yl-carbamoyl)benzenboronic acid, HCl, is utilized as a coupling partner in Suzuki-Miyaura cross-coupling reactions, a widely used method for the formation of carbon-carbon bonds. Its presence in these reactions enables the synthesis of complex organic molecules with potential applications in various fields, including materials science and medicinal chemistry.
Used in Aqueous Reactions:
The hydrochloric acid salt form of 3-(1H-tetrazol-5-yl-carbamoyl)benzenboronic acid enhances its solubility in water, making it suitable for use in aqueous reactions. This feature expands the range of applications for the compound, allowing for its use in various chemical processes that require an aqueous environment.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-38-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 850567-38:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*3)+(1*8)=183
183 % 10 = 3
So 850567-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BN5O3.ClH/c15-7(10-8-11-13-14-12-8)5-2-1-3-6(4-5)9(16)17;/h1-4,16-17H,(H2,10,11,12,13,14,15);1H
