850567-61-2 Usage
General Description
"(2-Vinylphenyl)boronic acid, propanediol cyclic ester" is a chemical compound that combines the traits of (2-vinylphenyl)boronic acid and propanediol cyclic ester. (2-VINYLPHENYL)BORONIC ACID, PROPANEDIOL CYCLIC ESTER is used in organic synthesis and polymer chemistry, specifically in the preparation of boronic acid derivatives and in the formation of cyclic esters. The (2-vinylphenyl)boronic acid portion of the compound serves as a versatile building block for various chemical reactions, while the propanediol cyclic ester portion contributes to the formation of polymers and other materials. (2-VINYLPHENYL)BORONIC ACID, PROPANEDIOL CYCLIC ESTER has potential applications in the development of new materials, drug synthesis, and other industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-61-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 850567-61:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*6)+(1*1)=182
182 % 10 = 2
So 850567-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BO2/c1-2-10-6-3-4-7-11(10)12-13-8-5-9-14-12/h2-4,6-7H,1,5,8-9H2
