850567-61-2 Usage
Uses
Used in Organic Synthesis:
(2-Vinylphenyl)boronic acid, propanediol cyclic ester is used as a building block for various chemical reactions in organic synthesis. The (2-vinylphenyl)boronic acid portion of the compound provides versatility in reaction pathways, enabling the formation of a broad range of chemical products.
Used in Polymer Chemistry:
In polymer chemistry, (2-Vinylphenyl)boronic acid, propanediol cyclic ester is used as a key component in the formation of polymers and other materials. The propanediol cyclic ester segment contributes to the structural integrity and properties of the resulting polymers, making it suitable for various applications.
Used in Material Development:
(2-Vinylphenyl)boronic acid, propanediol cyclic ester is used as a precursor in the development of new materials. Its unique structure allows for the creation of materials with specific properties, such as enhanced stability, reactivity, or selectivity, which can be tailored for various applications.
Used in Drug Synthesis:
In the pharmaceutical industry, (2-Vinylphenyl)boronic acid, propanediol cyclic ester is used as an intermediate in the synthesis of drugs. Its ability to participate in various chemical reactions makes it a valuable component in the development of new drug molecules with potential therapeutic effects.
Used in Industrial Processes:
(2-Vinylphenyl)boronic acid, propanediol cyclic ester is utilized in various industrial processes, where its unique properties can be harnessed to improve the efficiency, selectivity, or yield of chemical reactions. This can lead to the production of higher quality products or more sustainable manufacturing processes.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-61-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 850567-61:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*6)+(1*1)=182
182 % 10 = 2
So 850567-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BO2/c1-2-10-6-3-4-7-11(10)12-13-8-5-9-14-12/h2-4,6-7H,1,5,8-9H2
