850567-96-3 Usage
Uses
Used in Organic Synthesis:
4-(Methoxycarbonylamino)benzeneboronic acid is used as a reagent in various chemical reactions, particularly in the Suzuki coupling process. This reaction is a widely employed method for the formation of carbon-carbon bonds, which is crucial in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(Methoxycarbonylamino)benzeneboronic acid is used as a building block for the development of new drugs. Its unique structure allows for the creation of novel compounds with potential therapeutic applications.
Used in Material Science:
4-(Methoxycarbonylamino)benzeneboronic acid is also used in material science for the synthesis of new materials with specific properties. Its boron-containing structure can contribute to the development of materials with unique electronic, optical, or mechanical characteristics.
Safety Handling:
While the scientific knowledge about 4-(Methoxycarbonylamino)benzeneboronic acid is rich, the compound's exact applications and safety handling procedures should be referenced from specific material safety data sheets. This ensures that proper precautions are taken during its use, storage, and disposal to minimize any potential risks to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-96-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 850567-96:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*9)+(1*6)=193
193 % 10 = 3
So 850567-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BNO4/c1-14-8(11)10-7-4-2-6(3-5-7)9(12)13/h2-5,12-13H,1H3,(H,10,11)
850567-96-3Relevant academic research and scientific papers
COMPOUNDS, COMPOSITIONS, AND METHODS FOR SUPPRESSING TOXIC ENDOPLASMIC RETICULUM STRESS
-
Paragraph 0321; 0409-0411; 0414, (2019/09/18)
The present invention provides, inter alia, a compound having the structure (I). Also provided are compositions containing a pharmaceutically acceptable carrier and one or more compounds according to the present invention. Further provided are methods for treating or ameliorating the effects of a disorder in a subject, methods of suppressing the toxicity of endoplasmic reticulum (ER) stress in a subject, methods of treating or ameliorating the effects of a disease involving axon degeneration in a subject, and methods for treating or ameliorating the effects of a neurodegenerative disease.
