850567-99-6 Usage
Uses
Used in Organic Synthesis:
3-[(E)-2-NITROVINYL]PHENYLBORONIC ACID is used as a reagent in organic synthesis for the preparation of various organic compounds. Its unique structure, featuring the nitro and vinyl groups, allows for a variety of chemical reactions and transformations, making it a valuable building block in the creation of advanced materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-[(E)-2-NITROVINYL]PHENYLBORONIC ACID is used as a key intermediate in the synthesis of drugs. Its presence in the molecular structure can contribute to the development of new pharmaceuticals with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
3-[(E)-2-NITROVINYL]PHENYLBORONIC ACID is also utilized in the agrochemical industry as a precursor for the synthesis of agrochemicals. Its ability to participate in various chemical reactions makes it suitable for the development of new agrochemicals with enhanced performance and selectivity.
Used in Materials Science:
In the field of materials science, 3-[(E)-2-NITROVINYL]PHENYLBORONIC ACID is used as a building block for the creation of advanced materials. Its unique chemical properties and reactivity can contribute to the development of new materials with improved properties and applications.
Used in Drug Discovery and Development:
3-[(E)-2-NITROVINYL]PHENYLBORONIC ACID has potential applications in drug discovery and development. Its presence in the molecular structure can lead to the identification of new drug candidates with novel mechanisms of action and therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-99-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 850567-99:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*9)+(1*9)=196
196 % 10 = 6
So 850567-99-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BNO4/c11-9(12)8-3-1-2-7(6-8)4-5-10(13)14/h1-6,11-12H/b5-4+
