850568-07-9 Usage
Uses
Used in Organic Synthesis:
(2-Carboxy-4-chloro)benzeneboronic acid is used as a building block for the synthesis of various biologically active molecules and pharmaceuticals. Its unique structure allows for the formation of complex organic compounds that can exhibit a range of biological activities.
Used in Pharmaceutical Research:
In pharmaceutical research, (2-Carboxy-4-chloro)benzeneboronic acid is utilized as a reagent in Suzuki-Miyaura cross-coupling reactions, a method widely employed for forming carbon-carbon bonds in organic chemistry. This reaction is crucial for the development of new pharmaceutical compounds with improved efficacy and selectivity.
Used in Drug Discovery and Development:
The presence of the boronic acid group in (2-Carboxy-4-chloro)benzeneboronic acid makes it a useful tool for binding to specific biological targets. This property is particularly valuable in drug discovery and development, where the compound can be used to identify and optimize potential drug candidates with high target affinity and selectivity.
Used in the Preparation of Bioactive Molecules:
(2-Carboxy-4-chloro)benzeneboronic acid is employed as a key intermediate in the preparation of bioactive molecules with potential applications in medicine and biology. Its structural features enable the design of molecules with specific biological activities, such as enzyme inhibition, receptor modulation, or other therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 850568-07:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*0)+(1*7)=179
179 % 10 = 9
So 850568-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BClO4/c9-4-1-2-6(8(12)13)5(3-4)7(10)11/h1-3,12-13H,(H,10,11)
